EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H17NO4 |
| Net Charge | 0 |
| Average Mass | 215.249 |
| Monoisotopic Mass | 215.11576 |
| SMILES | CC/C=C/CCC(NCC(=O)O)C(=O)O |
| InChI | InChI=1S/C10H17NO4/c1-2-3-4-5-6-8(10(14)15)11-7-9(12)13/h3-4,8,11H,2,5-7H2,1H3,(H,12,13)(H,14,15)/b4-3+ |
| InChIKey | KTHQNAJPRGYGBS-ONEGZZNKSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| synthetic microbial community (ncbitaxon:3229850) | Whole Organism (NCIT:C13413) | MetaboLights (MTBLS3129) |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1-hydroxyoct-5-enoylglycine (CHEBI:193759) is a α-amino acid (CHEBI:33704) |
| IUPAC Name |
|---|
| (E)-2-(carboxymethylamino)oct-5-enoic acid |
| Manual Xrefs | Databases |
|---|---|
| 74849644 | ChemSpider |