EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H12N2O5 |
| Net Charge | 0 |
| Average Mass | 204.182 |
| Monoisotopic Mass | 204.07462 |
| SMILES | CC(NC(=O)CC(N)C(=O)O)C(=O)O |
| InChI | InChI=1S/C7H12N2O5/c1-3(6(11)12)9-5(10)2-4(8)7(13)14/h3-4H,2,8H2,1H3,(H,9,10)(H,11,12)(H,13,14) |
| InChIKey | ARSVRKCVNFIICJ-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| synthetic microbial community (ncbitaxon:3229850) | Whole Organism (NCIT:C13413) | MetaboLights (MTBLS3129) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| L-beta-aspartyl-L-alanine (CHEBI:193747) is a N-acyl-amino acid (CHEBI:51569) |
| IUPAC Name |
|---|
| 2-amino-4-(1-carboxyethylamino)-4-oxobutanoic acid |
| Manual Xrefs | Databases |
|---|---|
| HMDB0011162 | HMDB |
| 20129866 | ChemSpider |