EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H13N3O |
| Net Charge | 0 |
| Average Mass | 203.245 |
| Monoisotopic Mass | 203.10586 |
| SMILES | C[C@@H]1CC(=O)NN=C1c1ccc(N)cc1 |
| InChI | InChI=1S/C11H13N3O/c1-7-6-10(15)13-14-11(7)8-2-4-9(12)5-3-8/h2-5,7H,6,12H2,1H3,(H,13,15)/t7-/m1/s1 |
| InChIKey | GDMRFHZLKNYRRO-SSDOTTSWSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| synthetic microbial community (ncbitaxon:3229850) | Whole Organism (NCIT:C13413) | MetaboLights (MTBLS3129) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| OR-1855 (CHEBI:193746) is a substituted aniline (CHEBI:48975) |
| IUPAC Name |
|---|
| (4R)-3-(4-aminophenyl)-4-methyl-4,5-dihydro-1H-pyridazin-6-one |
| Manual Xrefs | Databases |
|---|---|
| 8640895 | ChemSpider |
| HMDB0060860 | HMDB |
| Registry Numbers | Sources |
|---|---|
| CAS:101328-85-2 | ChemIDplus |