EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H10N2O5 |
| Net Charge | 0 |
| Average Mass | 190.155 |
| Monoisotopic Mass | 190.05897 |
| SMILES | NCC(=O)NC(CC(=O)O)C(=O)O |
| InChI | InChI=1S/C6H10N2O5/c7-2-4(9)8-3(6(12)13)1-5(10)11/h3H,1-2,7H2,(H,8,9)(H,10,11)(H,12,13) |
| InChIKey | SCCPDJAQCXWPTF-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| synthetic microbial community (ncbitaxon:3229850) | Whole Organism (NCIT:C13413) | MetaboLights (MTBLS3129) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Glycyl-Aspartate (CHEBI:193741) is a dipeptide (CHEBI:46761) |
| IUPAC Name |
|---|
| 2-[(2-aminoacetyl)amino]butanedioic acid |
| Manual Xrefs | Databases |
|---|---|
| 240419 | ChemSpider |
| D90714 | KEGG DRUG |
| HMDB0028837 | HMDB |