EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H2Cl2O5 |
| Net Charge | -2 |
| Average Mass | 224.983 |
| Monoisotopic Mass | 223.92903 |
| SMILES | [H]C(C(=O)C(Cl)C(=O)[O-])=C(Cl)C(=O)[O-] |
| InChI | InChI=1S/C6H4Cl2O5/c7-2(5(10)11)1-3(9)4(8)6(12)13/h1,4H,(H,10,11)(H,12,13)/p-2 |
| InChIKey | PLPVRWUZGSFJJB-UHFFFAOYSA-L |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2,5-dichloro-4-oxohex-2-enedioate(2−) (CHEBI:19373) has functional parent 4-oxohex-2-enedioate (CHEBI:12040) |
| 2,5-dichloro-4-oxohex-2-enedioate(2−) (CHEBI:19373) is a oxo dicarboxylate (CHEBI:36147) |
| 2,5-dichloro-4-oxohex-2-enedioate(2−) (CHEBI:19373) is conjugate base of 2,5-dichloro-4-oxohex-2-enedioic acid (CHEBI:31074) |
| Incoming Relation(s) |
| 2,5-dichloro-4-oxohex-2-enedioic acid (CHEBI:31074) is conjugate acid of 2,5-dichloro-4-oxohex-2-enedioate(2−) (CHEBI:19373) |
| IUPAC Name |
|---|
| 2,5-dichloro-4-oxohex-2-enedioate |
| Synonym | Source |
|---|---|
| 2,5-dichloro-4-oxohex-2-enedioate dianion | ChEBI |