EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H14N2O3 |
| Net Charge | 0 |
| Average Mass | 174.200 |
| Monoisotopic Mass | 174.10044 |
| SMILES | CCCC(NC(=O)CN)C(=O)O |
| InChI | InChI=1S/C7H14N2O3/c1-2-3-5(7(11)12)9-6(10)4-8/h5H,2-4,8H2,1H3,(H,9,10)(H,11,12) |
| InChIKey | JXIQKLAZYWZTRA-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| synthetic microbial community (ncbitaxon:3229850) | Whole Organism (NCIT:C13413) | MetaboLights (MTBLS3129) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Gly-Norvaline (CHEBI:193725) is a peptide (CHEBI:16670) |
| IUPAC Name |
|---|
| 2-[(2-aminoacetyl)amino]pentanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 78338 | ChemSpider |
| Registry Numbers | Sources |
|---|---|
| CAS:19257-03-5 | ChemIDplus |