EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H13NO2 |
| Net Charge | 0 |
| Average Mass | 167.208 |
| Monoisotopic Mass | 167.09463 |
| SMILES | CC(N)Cc1ccc(O)c(O)c1 |
| InChI | InChI=1S/C9H13NO2/c1-6(10)4-7-2-3-8(11)9(12)5-7/h2-3,5-6,11-12H,4,10H2,1H3 |
| InChIKey | KSRGADMGIRTXAF-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| synthetic microbial community (ncbitaxon:3229850) | Whole Organism (NCIT:C13413) | MetaboLights (MTBLS3129) |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Application: | central nervous system stimulant Any drug that enhances the activity of the central nervous system. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| a-Methyldopamine (CHEBI:193722) is a amphetamines (CHEBI:35338) |
| IUPAC Name |
|---|
| 4-(2-aminopropyl)benzene-1,2-diol |
| Manual Xrefs | Databases |
|---|---|
| 16110 | ChemSpider |
| HMDB0060807 | HMDB |
| Registry Numbers | Sources |
|---|---|
| CAS:555-64-6 | ChemIDplus |