EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H8N2O |
| Net Charge | 0 |
| Average Mass | 136.154 |
| Monoisotopic Mass | 136.06366 |
| SMILES | NC(=O)c1ccccc1N |
| InChI | InChI=1S/C7H8N2O/c8-6-4-2-1-3-5(6)7(9)10/h1-4H,8H2,(H2,9,10) |
| InChIKey | PXBFMLJZNCDSMP-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| synthetic microbial community (ncbitaxon:3229850) | Whole Organism (NCIT:C13413) | MetaboLights (MTBLS3129) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-Aminobenzamide (CHEBI:193638) is a substituted aniline (CHEBI:48975) |
| IUPAC Name |
|---|
| 2-aminobenzamide |
| Manual Xrefs | Databases |
|---|---|
| 10298355 | ChemSpider |
| C17512 | KEGG COMPOUND |
| D71115 | KEGG DRUG |
| HMDB0033947 | HMDB |
| Registry Numbers | Sources |
|---|---|
| CAS:88-68-6 | ChemIDplus |