EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H11NO2 |
| Net Charge | 0 |
| Average Mass | 129.159 |
| Monoisotopic Mass | 129.07898 |
| SMILES | O=C(O)N1CCCCC1 |
| InChI | InChI=1S/C6H11NO2/c8-6(9)7-4-2-1-3-5-7/h1-5H2,(H,8,9) |
| InChIKey | DNUTZBZXLPWRJG-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| synthetic microbial community (ncbitaxon:3229850) | Whole Organism (NCIT:C13413) | MetaboLights (MTBLS3129) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1-Piperidine carboxylic acid (CHEBI:193631) is a carboxylic acid (CHEBI:33575) |
| 1-Piperidine carboxylic acid (CHEBI:193631) is a piperidines (CHEBI:26151) |
| IUPAC Name |
|---|
| piperidine-1-carboxylic acid |
| Manual Xrefs | Databases |
|---|---|
| 8139688 | ChemSpider |
| Registry Numbers | Sources |
|---|---|
| CAS:13406-98-9 | ChemIDplus |