EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C4H9NO3 |
| Net Charge | 0 |
| Average Mass | 119.120 |
| Monoisotopic Mass | 119.05824 |
| SMILES | NCCOCC(=O)O |
| InChI | InChI=1S/C4H9NO3/c5-1-2-8-3-4(6)7/h1-3,5H2,(H,6,7) |
| InChIKey | GNRLUBOJIGSVNT-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| synthetic microbial community (ncbitaxon:3229850) | Whole Organism (NCIT:C13413) | MetaboLights (MTBLS3129) |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Aminoethoxyacetic acid (CHEBI:193617) is a amino acid (CHEBI:33709) |
| IUPAC Name |
|---|
| 2-(2-aminoethoxy)acetic acid |
| Manual Xrefs | Databases |
|---|---|
| 9346048 | ChemSpider |
| Registry Numbers | Sources |
|---|---|
| CAS:10366-71-9 | ChemIDplus |