EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H8O3 |
| Net Charge | 0 |
| Average Mass | 116.116 |
| Monoisotopic Mass | 116.04734 |
| SMILES | C/C=C(/CO)C(=O)O |
| InChI | InChI=1S/C5H8O3/c1-2-4(3-6)5(7)8/h2,6H,3H2,1H3,(H,7,8)/b4-2- |
| InChIKey | BAOHMJZBCIUQEO-RQOWECAXSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| synthetic microbial community (ncbitaxon:3229850) | Whole Organism (NCIT:C13413) | MetaboLights (MTBLS3129) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-(hydroxymethyl)but-2-enoic acid (CHEBI:193614) is a hydroxy fatty acid (CHEBI:24654) |
| IUPAC Name |
|---|
| (Z)-2-(hydroxymethyl)but-2-enoic acid |
| Manual Xrefs | Databases |
|---|---|
| 61304722 | ChemSpider |