EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H8O2 |
| Net Charge | 0 |
| Average Mass | 100.117 |
| Monoisotopic Mass | 100.05243 |
| SMILES | C=CC(C)C(=O)O |
| InChI | InChI=1S/C5H8O2/c1-3-4(2)5(6)7/h3-4H,1H2,2H3,(H,6,7) |
| InChIKey | GQWNPIKWYPQUPI-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| synthetic microbial community (ncbitaxon:3229850) | Whole Organism (NCIT:C13413) | MetaboLights (MTBLS3129) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-methylbut-3-enoic acid (CHEBI:193604) is a branched-chain fatty acid (CHEBI:35819) |
| IUPAC Name |
|---|
| 2-methylbut-3-enoic acid |
| Manual Xrefs | Databases |
|---|---|
| 126228 | ChemSpider |
| Registry Numbers | Sources |
|---|---|
| CAS:53774-20-2 | ChemIDplus |