EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H17ClF2N4O2 |
| Net Charge | 0 |
| Average Mass | 430.842 |
| Monoisotopic Mass | 430.10081 |
| SMILES | C=CC(=O)N1CCN(c2ncnc3c(F)c(-c4c(O)cccc4F)c(Cl)cc23)CC1 |
| InChI | InChI=1S/C21H17ClF2N4O2/c1-2-16(30)27-6-8-28(9-7-27)21-12-10-13(22)17(19(24)20(12)25-11-26-21)18-14(23)4-3-5-15(18)29/h2-5,10-11,29H,1,6-9H2 |
| InChIKey | ZRPZPNYZFSJUPA-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | inhibitor A substance that diminishes the rate of a chemical reaction. antiviral agent A substance that destroys or inhibits replication of viruses. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ARS-1620 (CHEBI:193597) has role antineoplastic agent (CHEBI:35610) |
| ARS-1620 (CHEBI:193597) has role antiviral agent (CHEBI:22587) |
| ARS-1620 (CHEBI:193597) has role inhibitor (CHEBI:35222) |
| ARS-1620 (CHEBI:193597) is a quinazolines (CHEBI:38530) |
| IUPAC Name |
|---|
| 1-{4-[(7Sa)-6-chloro-8-fluoro-7-(2-fluoro-6-hydroxyphenyl)quinazolin-4-yl]piperazin-1-yl}prop-2-en-1-one |
| Synonyms | Source |
|---|---|
| 1-[4-[(7S)-6-chloro-8-fluoro-7-[(1S)-2-fluoro-6-hydroxyphenyl]-4-quinazolinyl]-1-piperazinyl]-2-propen-1-one | ChEBI |
| ARS 1620 | ChEBI |
| (S)-1-{4-[6-chloro-8-fluoro-7-(2-fluoro-6-hydroxyphenyl)quinazolin-4-yl] piperazin-1-yl}propan-1-one | PDBeChem |
| Manual Xrefs | Databases |
|---|---|
| 91S | PDBeChem |
| Citations |
|---|