EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H14N2 |
| Net Charge | 0 |
| Average Mass | 162.236 |
| Monoisotopic Mass | 162.11570 |
| SMILES | CN1CCCC1c1ccccn1 |
| InChI | InChI=1S/C10H14N2/c1-12-8-4-6-10(12)9-5-2-3-7-11-9/h2-3,5,7,10H,4,6,8H2,1H3 |
| InChIKey | AQCRXZYYMOXFAN-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Nicotiana tabacum (ncbitaxon:4097) | leaf (BTO:0000713) | MetaboLights (MTBLS2042) | Strain: Nicotiana tabacum cv. Petit Havana |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-(1-methyl-2-pyrrolidinyl)-pyridine (CHEBI:193564) is a aralkylamine (CHEBI:18000) |
| IUPAC Name |
|---|
| 2-(1-methylpyrrolidin-2-yl)pyridine |
| Registry Numbers | Sources |
|---|---|
| CAS:23950-04-1 | SUBMITTER |