EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H17N3O2S |
| Net Charge | 0 |
| Average Mass | 315.398 |
| Monoisotopic Mass | 315.10415 |
| SMILES | O=C(O)C1Cc2c(nc3ccccc23)C(C2CCNC2=S)N1 |
| InChI | InChI=1S/C16H17N3O2S/c20-16(21)12-7-10-8-3-1-2-4-11(8)18-14(10)13(19-12)9-5-6-17-15(9)22/h1-4,9,12-13,18-19H,5-7H2,(H,17,22)(H,20,21) |
| InChIKey | YHAYSIGUKKXZJH-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | feces (BTO:0000440) | MetaboLights (MTBLS5335) |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (1R*,3R*,3'S*)-1,2,3,4-Tetrahydro-1-(2-thio-3-pyrrolidinyl)-beta-carboline-3-carboxylic acid (CHEBI:193547) is a harmala alkaloid (CHEBI:61379) |
| IUPAC Name |
|---|
| 1-(2-sulanylidenepyrrolidin-3-yl)-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole-3-carboxylic acid |
| Manual Xrefs | Databases |
|---|---|
| 2274658 | ChemSpider |
| HMDB0034767 | HMDB |