EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H16O4 |
| Net Charge | 0 |
| Average Mass | 248.278 |
| Monoisotopic Mass | 248.10486 |
| SMILES | [H]/C(C(=O)O)=C(\[H])c1ccc(O)c(C/C([H])=C(\C)CO)c1 |
| InChI | InChI=1S/C14H16O4/c1-10(9-15)2-5-12-8-11(3-6-13(12)16)4-7-14(17)18/h2-4,6-8,15-16H,5,9H2,1H3,(H,17,18)/b7-4-,10-2+ |
| InChIKey | WIONBNBDOOYIGS-PDJRALLUSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | feces (BTO:0000440) | MetaboLights (MTBLS5335) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-{4-hydroxy-3-[(2E)-4-hydroxy-3-methylbut-2-en-1-yl]phenyl}prop-2-enoic acid (CHEBI:193534) is a hydroxycinnamic acid (CHEBI:24689) |