EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H38O5 |
| Net Charge | 0 |
| Average Mass | 454.607 |
| Monoisotopic Mass | 454.27192 |
| SMILES | [H][C@]1([C@@]2(C)O[C@]2([H])CC=C(C)C)[C@H](OC)[C@H](OC(=O)/C=C/C=C/C=C/C=C/C=C/C)CC[C@]12CO2 |
| InChI | InChI=1S/C28H38O5/c1-6-7-8-9-10-11-12-13-14-15-24(29)32-22-18-19-28(20-31-28)26(25(22)30-5)27(4)23(33-27)17-16-21(2)3/h6-16,22-23,25-26H,17-20H2,1-5H3/b7-6+,9-8+,11-10+,13-12+,15-14+/t22-,23-,25-,26-,27+,28+/m1/s1 |
| InChIKey | CBFRYQFEUIODNP-KIKJWTPJSA-N |
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| prefumagillin (CHEBI:193520) is a carboxylic ester (CHEBI:33308) |
| prefumagillin (CHEBI:193520) is a meroterpenoid (CHEBI:64419) |
| prefumagillin (CHEBI:193520) is a organooxygen heterocyclic antibiotic (CHEBI:25807) |
| prefumagillin (CHEBI:193520) is a spiro-epoxide (CHEBI:133131) |
| UniProt Name | Source |
|---|---|
| prefumagillin | UniProt |
| Manual Xrefs | Databases |
|---|---|
| CPD-26044 | MetaCyc |
| Citations |
|---|