EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H22O6 |
| Net Charge | 0 |
| Average Mass | 358.390 |
| Monoisotopic Mass | 358.14164 |
| SMILES | COc1cc2ccc1Oc1cc(ccc1O)C(O)CC(=O)CCCC2O |
| InChI | InChI=1S/C20H22O6/c1-25-20-10-12-6-8-18(20)26-19-9-13(5-7-16(19)23)17(24)11-14(21)3-2-4-15(12)22/h5-10,15,17,22-24H,2-4,11H2,1H3 |
| InChIKey | WYVHKKOLWTXMLT-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | feces (BTO:0000440) | MetaboLights (MTBLS5335) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4,8,14-trihydroxy-17-methoxy-2-oxatricyclo[13.2.2.13,7]icosa-1(17),3,5,7(20),15,18-hexaen-10-one (CHEBI:193515) is a diarylheptanoid (CHEBI:78802) |