EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H18N2O4 |
| Net Charge | 0 |
| Average Mass | 254.286 |
| Monoisotopic Mass | 254.12666 |
| SMILES | NC(CCCCNCC(=O)c1ccco1)C(=O)O |
| InChI | InChI=1S/C12H18N2O4/c13-9(12(16)17)4-1-2-6-14-8-10(15)11-5-3-7-18-11/h3,5,7,9,14H,1-2,4,6,8,13H2,(H,16,17) |
| InChIKey | YQHPCDPFXQXCMV-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | feces (BTO:0000440) | MetaboLights (MTBLS5335) |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| L-Furosine (CHEBI:193494) is a α-amino acid (CHEBI:33704) |
| IUPAC Name |
|---|
| 2-amino-6-[[2-(uran-2-yl)-2-oxoethyl]amino]hexanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 35032862 | ChemSpider |
| HMDB0029390 | HMDB |