EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H13NO6 |
| Net Charge | 0 |
| Average Mass | 255.226 |
| Monoisotopic Mass | 255.07429 |
| SMILES | COc1cc(C(=O)NCC(=O)O)cc(OC)c1O |
| InChI | InChI=1S/C11H13NO6/c1-17-7-3-6(4-8(18-2)10(7)15)11(16)12-5-9(13)14/h3-4,15H,5H2,1-2H3,(H,12,16)(H,13,14) |
| InChIKey | YOCUZTRAFVYAPT-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | feces (BTO:0000440) | MetaboLights (MTBLS5335) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-{[hydroxy(4-hydroxy-3,5-dimethoxyphenyl)methylidene]amino}acetic acid (CHEBI:193470) is a N-acyl-amino acid (CHEBI:51569) |
| IUPAC Name |
|---|
| 2-[(4-hydroxy-3,5-dimethoxybenzoyl)amino]acetic acid |
| Manual Xrefs | Databases |
|---|---|
| 57489981 | ChemSpider |