EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H9NO7 |
| Net Charge | 0 |
| Average Mass | 243.171 |
| Monoisotopic Mass | 243.03790 |
| SMILES | O=C(O)CNC(=O)c1c(O)cc(O)c(O)c1O |
| InChI | InChI=1S/C9H9NO7/c11-3-1-4(12)7(15)8(16)6(3)9(17)10-2-5(13)14/h1,11-12,15-16H,2H2,(H,10,17)(H,13,14) |
| InChIKey | PYZNKXANEQSKAW-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | feces (BTO:0000440) | MetaboLights (MTBLS5335) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-{[hydroxy(2,3,4,6-tetrahydroxyphenyl)methylidene]amino}acetic acid (CHEBI:193459) is a N-acyl-amino acid (CHEBI:51569) |
| IUPAC Name |
|---|
| 2-[(2,3,4,6-tetrahydroxybenzoyl)amino]acetic acid |
| Manual Xrefs | Databases |
|---|---|
| 74852872 | ChemSpider |