EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H18O5 |
| Net Charge | 0 |
| Average Mass | 254.282 |
| Monoisotopic Mass | 254.11542 |
| SMILES | Cc1cc(CCCCC(=O)O)oc1CCC(=O)O |
| InChI | InChI=1S/C13H18O5/c1-9-8-10(4-2-3-5-12(14)15)18-11(9)6-7-13(16)17/h8H,2-7H2,1H3,(H,14,15)(H,16,17) |
| InChIKey | VVSJZDOVZWFSID-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | feces (BTO:0000440) | MetaboLights (MTBLS5335) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-methyl-5-carboxyethyl-2-furanpentanoic acid (CHEBI:193420) is a heterocyclic fatty acid (CHEBI:48847) |
| IUPAC Name |
|---|
| 5-[5-(2-carboxyethyl)-4-methyluran-2-yl]pentanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 113368396 | ChemSpider |
| LMFA01150054 | LIPID MAPS |