EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H9N3O2 |
| Net Charge | 0 |
| Average Mass | 167.168 |
| Monoisotopic Mass | 167.06948 |
| SMILES | Cc1c(N)cc(N)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C7H9N3O2/c1-4-6(9)2-5(8)3-7(4)10(11)12/h2-3H,8-9H2,1H3 |
| InChIKey | DFZSBQYOXAUYCB-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | xenobiotic metabolite Any metabolite produced by metabolism of a xenobiotic compound. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2,4-diamino-6-nitrotoluene (CHEBI:19342) has role xenobiotic metabolite (CHEBI:76206) |
| 2,4-diamino-6-nitrotoluene (CHEBI:19342) is a amino-nitrotoluene (CHEBI:22482) |
| IUPAC Name |
|---|
| 4-methyl-5-nitrobenzene-1,3-diamine |
| Synonym | Source |
|---|---|
| 2-Nitro-4,6-diaminotoluene | ChemIDplus |
| UniProt Name | Source |
|---|---|
| 2,4-diamino-6-nitrotoluene | UniProt |
| Manual Xrefs | Databases |
|---|---|
| C16396 | KEGG COMPOUND |
| HMDB0060362 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:3049869 | Reaxys |
| CAS:6629-29-4 | KEGG COMPOUND |
| CAS:6629-29-4 | ChemIDplus |