EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H18O5 |
| Net Charge | 0 |
| Average Mass | 266.293 |
| Monoisotopic Mass | 266.11542 |
| SMILES | COc1c(CC=C(C)C)c(O)cc(O)c1CC(=O)O |
| InChI | InChI=1S/C14H18O5/c1-8(2)4-5-9-11(15)7-12(16)10(6-13(17)18)14(9)19-3/h4,7,15-16H,5-6H2,1-3H3,(H,17,18) |
| InChIKey | CRNYOXYZHUISBD-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | feces (BTO:0000440) | MetaboLights (MTBLS5335) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-[4,6-dihydroxy-2-methoxy-3-(3-methylbut-2-en-1-yl)phenyl]acetic acid (CHEBI:193415) is a phenols (CHEBI:33853) |
| 2-[4,6-dihydroxy-2-methoxy-3-(3-methylbut-2-en-1-yl)phenyl]acetic acid (CHEBI:193415) is a phenylacetic acids (CHEBI:25978) |
| IUPAC Name |
|---|
| 2-[4,6-dihydroxy-2-methoxy-3-(3-methylbut-2-enyl)phenyl]acetic acid |
| Manual Xrefs | Databases |
|---|---|
| 74851714 | ChemSpider |