EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H11N3O |
| Net Charge | 0 |
| Average Mass | 153.185 |
| Monoisotopic Mass | 153.09021 |
| SMILES | Cc1c(N)cc(N)cc1NO |
| InChI | InChI=1S/C7H11N3O/c1-4-6(9)2-5(8)3-7(4)10-11/h2-3,10-11H,8-9H2,1H3 |
| InChIKey | DAAYGLKRMDTNSS-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | xenobiotic metabolite Any metabolite produced by metabolism of a xenobiotic compound. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2,4-diamino-6-hydroxylaminotoluene (CHEBI:19341) has role xenobiotic metabolite (CHEBI:76206) |
| 2,4-diamino-6-hydroxylaminotoluene (CHEBI:19341) is a aminotoluene (CHEBI:22531) |
| 2,4-diamino-6-hydroxylaminotoluene (CHEBI:19341) is a hydroxylamines (CHEBI:24709) |
| IUPAC Name |
|---|
| N1-hydroxy-2-methylbenzene-1,3,5-triamine |
| UniProt Name | Source |
|---|---|
| 2,4-diamino-6-hydroxylaminotoluene | UniProt |