EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H12O4 |
| Net Charge | 0 |
| Average Mass | 208.213 |
| Monoisotopic Mass | 208.07356 |
| SMILES | COc1ccc(C=CC(=O)O)cc1OC |
| InChI | InChI=1S/C11H12O4/c1-14-9-5-3-8(4-6-11(12)13)7-10(9)15-2/h3-7H,1-2H3,(H,12,13) |
| InChIKey | HJBWJAPEBGSQPR-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | feces (BTO:0000440) | MetaboLights (MTBLS5335) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-(3,4-dimethoxyphenyl)prop-2-enoic acid (CHEBI:193396) is a hydroxycinnamic acid (CHEBI:24689) |
| IUPAC Name |
|---|
| 3-(3,4-dimethoxyphenyl)prop-2-enoic acid |
| Manual Xrefs | Databases |
|---|---|
| 15967 | ChemSpider |