EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H11NO6 |
| Net Charge | 0 |
| Average Mass | 241.199 |
| Monoisotopic Mass | 241.05864 |
| SMILES | COc1cc(C(=O)NCC(=O)O)cc(O)c1O |
| InChI | InChI=1S/C10H11NO6/c1-17-7-3-5(2-6(12)9(7)15)10(16)11-4-8(13)14/h2-3,12,15H,4H2,1H3,(H,11,16)(H,13,14) |
| InChIKey | UKFFJSITCNRUQV-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | feces (BTO:0000440) | MetaboLights (MTBLS5335) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-{[(3,4-dihydroxy-5-methoxyphenyl)(hydroxy)methylidene]amino}acetic acid (CHEBI:193395) is a N-acyl-amino acid (CHEBI:51569) |
| IUPAC Name |
|---|
| 2-[(3,4-dihydroxy-5-methoxybenzoyl)amino]acetic acid |
| Manual Xrefs | Databases |
|---|---|
| 74852094 | ChemSpider |