EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H30O2 |
| Net Charge | 0 |
| Average Mass | 290.447 |
| Monoisotopic Mass | 290.22458 |
| SMILES | CC[C@@H](C)CC/C=C/C(C)=C/[C@H](C)C/C=C/C=C/C(=O)O |
| InChI | InChI=1S/C19H30O2/c1-5-16(2)11-9-10-13-18(4)15-17(3)12-7-6-8-14-19(20)21/h6-8,10,13-17H,5,9,11-12H2,1-4H3,(H,20,21)/b7-6+,13-10+,14-8+,18-15+/t16-,17-/m1/s1 |
| InChIKey | AHLLEVZDNYBWMJ-SCSFZPQPSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | feces (BTO:0000440) | MetaboLights (MTBLS5335) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 16:4(2E,4E,8E,10E)(7Me[R],9Me,14Me[R]) (CHEBI:193385) is a long-chain fatty acid (CHEBI:15904) |
| IUPAC Name |
|---|
| (2E,4E,7R,8E,10E,14R)-7,9,14-trimethylhexadeca-2,4,8,10-tetraenoic acid |
| Manual Xrefs | Databases |
|---|---|
| 113369094 | ChemSpider |
| LMFA01020370 | LIPID MAPS |