EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:193383 - 7-hydroxy-10-heptadecen-8-ynoic acid
| Formula | C17H30O3 |
| Net Charge | 0 |
| Average Mass | 282.424 |
| Monoisotopic Mass | 282.21949 |
| SMILES | CCCCCCCCC#CC(O)CCCCCC(=O)O |
| InChI | InChI=1S/C17H30O3/c1-2-3-4-5-6-7-8-10-13-16(18)14-11-9-12-15-17(19)20/h16,18H,2-9,11-12,14-15H2,1H3,(H,19,20) |
| InChIKey | TWMRPCHSQJOLLE-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | feces (BTO:0000440) | MetaboLights (MTBLS5335) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 7-hydroxy-10-heptadecen-8-ynoic acid (CHEBI:193383) is a long-chain fatty acid (CHEBI:15904) |
| IUPAC Name |
|---|
| 7-hydroxyheptadec-8-ynoic acid |
| Manual Xrefs | Databases |
|---|---|
| 4472238 | ChemSpider |
| LMFA01050260 | LIPID MAPS |