EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H18O2 |
| Net Charge | 0 |
| Average Mass | 182.263 |
| Monoisotopic Mass | 182.13068 |
| SMILES | CCCC#CCCCCCC(=O)O |
| InChI | InChI=1S/C11H18O2/c1-2-3-4-5-6-7-8-9-10-11(12)13/h2-3,6-10H2,1H3,(H,12,13) |
| InChIKey | HCVQILXMEVXFTC-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | feces (BTO:0000440) | MetaboLights (MTBLS5335) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 7-undecynoic acid (CHEBI:193382) is a medium-chain fatty acid (CHEBI:59554) |
| IUPAC Name |
|---|
| undec-7-ynoic acid |
| Manual Xrefs | Databases |
|---|---|
| 4472159 | ChemSpider |
| LMFA01030615 | LIPID MAPS |