EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H46O2 |
| Net Charge | 0 |
| Average Mass | 390.652 |
| Monoisotopic Mass | 390.34978 |
| SMILES | CCCCCCCC/C=C/CCCCCC/C=C/CC/C=C/CCCC(=O)O |
| InChI | InChI=1S/C26H46O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-23-24-25-26(27)28/h9-10,17-18,21-22H,2-8,11-16,19-20,23-25H2,1H3,(H,27,28)/b10-9+,18-17+,22-21+ |
| InChIKey | YZGHHOSIGGODQN-OWWJQZNRSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | feces (BTO:0000440) | MetaboLights (MTBLS5335) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 5,9,17-hexacosatrienoic acid (CHEBI:193346) is a very long-chain fatty acid (CHEBI:27283) |
| IUPAC Name |
|---|
| (5E,9E,17E)-hexacosa-5,9,17-trienoic acid |
| Manual Xrefs | Databases |
|---|---|
| 4472000 | ChemSpider |
| LMFA01030426 | LIPID MAPS |