EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H42O3 |
| Net Charge | 0 |
| Average Mass | 402.619 |
| Monoisotopic Mass | 402.31340 |
| SMILES | CCCCCC/C=C\CCCCCCCC/C=C\CCc1ccc(CC(=O)O)o1 |
| InChI | InChI=1S/C26H42O3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-24-21-22-25(29-24)23-26(27)28/h7-8,17-18,21-22H,2-6,9-16,19-20,23H2,1H3,(H,27,28)/b8-7-,18-17- |
| InChIKey | WRGYPEJIHKRYHB-GROAESOISA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | feces (BTO:0000440) | MetaboLights (MTBLS5335) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-(5-((3Z,13Z)-eicosa-3,13-dien-1-yl)furan-2-yl)-ethanoic acid (CHEBI:193333) is a heterocyclic fatty acid (CHEBI:48847) |
| IUPAC Name |
|---|
| 2-[5-[(3Z,13Z)-icosa-3,13-dienyl]uran-2-yl]acetic acid |
| Manual Xrefs | Databases |
|---|---|
| 10473274 | ChemSpider |
| LMFA01150034 | LIPID MAPS |