EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H40O6 |
| Net Charge | 0 |
| Average Mass | 424.578 |
| Monoisotopic Mass | 424.28249 |
| SMILES | C[C@]12CCC3C(C(O)CC4C[C@H](O)C[C@@H](O)[C@@]43C)C1CCC2[C@H](O)CCCC(=O)O |
| InChI | InChI=1S/C24H40O6/c1-23-9-8-17-22(16(23)7-6-15(23)18(26)4-3-5-21(29)30)19(27)11-13-10-14(25)12-20(28)24(13,17)2/h13-20,22,25-28H,3-12H2,1-2H3,(H,29,30)/t13?,14-,15?,16?,17?,18+,19?,20+,22?,23+,24-/m0/s1 |
| InChIKey | TVLHFFLEOSSHFT-ZLCDVOGVSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | feces (BTO:0000440) | MetaboLights (MTBLS5335) |
| Roles Classification |
|---|
| Biological Role: | androgen A sex hormone that stimulates or controls the development and maintenance of masculine characteristics in vertebrates by binding to androgen receptors. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1b,3a,7b-Trihydroxy-5b-cholanoic acid (CHEBI:193323) has role androgen (CHEBI:50113) |
| 1b,3a,7b-Trihydroxy-5b-cholanoic acid (CHEBI:193323) is a 3-hydroxy steroid (CHEBI:36834) |
| IUPAC Name |
|---|
| (5R)-5-hydroxy-5-[(1R,3S,7S,10S,13S)-1,3,7-trihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoic acid |
| Manual Xrefs | Databases |
|---|---|
| HMDB0013158 | HMDB |
| LMST04010246 | LIPID MAPS |