EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H18O2 |
| Net Charge | 0 |
| Average Mass | 206.285 |
| Monoisotopic Mass | 206.13068 |
| SMILES | O=C(O)CCCCCCc1ccccc1 |
| InChI | InChI=1S/C13H18O2/c14-13(15)11-7-2-1-4-8-12-9-5-3-6-10-12/h3,5-6,9-10H,1-2,4,7-8,11H2,(H,14,15) |
| InChIKey | ZVSXKFNTWOIGJI-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | feces (BTO:0000440) | MetaboLights (MTBLS5335) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 7-phenyl heptanoic acid (CHEBI:193307) is a medium-chain fatty acid (CHEBI:59554) |
| IUPAC Name |
|---|
| 7-phenylheptanoic acid |
| Manual Xrefs | Databases |
|---|---|
| LMFA01140063 | LIPID MAPS |
| 454436 | ChemSpider |