EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H12N4O3S |
| Net Charge | 0 |
| Average Mass | 328.353 |
| Monoisotopic Mass | 328.06301 |
| SMILES | O=C(O)CNC(=O)C1CSc2ncc3c4ccccc4nc-3n21 |
| InChI | InChI=1S/C15H12N4O3S/c20-12(21)6-16-14(22)11-7-23-15-17-5-9-8-3-1-2-4-10(8)18-13(9)19(11)15/h1-5,11H,6-7H2,(H,16,22)(H,20,21) |
| InChIKey | ZPXJZOIRMZYIAP-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | feces (BTO:0000440) | MetaboLights (MTBLS5335) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Cabbage identification factor 2 (CHEBI:193302) is a peptide (CHEBI:16670) |
| IUPAC Name |
|---|
| 2-(5-thia-2,7,16-triazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(16),6,8,10,12,14-hexaene-3-carbonylamino)acetic acid |
| Manual Xrefs | Databases |
|---|---|
| 35013643 | ChemSpider |
| HMDB0033622 | HMDB |