EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H14O6 |
| Net Charge | 0 |
| Average Mass | 302.282 |
| Monoisotopic Mass | 302.07904 |
| SMILES | CC1OC(CC(=O)O)CC2=C1C(=O)c1c(O)cccc1C2=O |
| InChI | InChI=1S/C16H14O6/c1-7-13-10(5-8(22-7)6-12(18)19)15(20)9-3-2-4-11(17)14(9)16(13)21/h2-4,7-8,17H,5-6H2,1H3,(H,18,19) |
| InChIKey | ZCJHPTKRISJQTN-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | feces (BTO:0000440) | MetaboLights (MTBLS5335) |
| Roles Classification |
|---|
| Biological Role: | antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Nanaomycin (CHEBI:193279) is a benzoisochromanequinone (CHEBI:48129) |
| IUPAC Name |
|---|
| 2-(9-hydroxy-1-methyl-5,10-dioxo-3,4-dihydro-1H-benzo[g]isochromen-3-yl)acetic acid |
| Manual Xrefs | Databases |
|---|---|
| 37080 | ChemSpider |