EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H10O4 |
| Net Charge | 0 |
| Average Mass | 194.186 |
| Monoisotopic Mass | 194.05791 |
| SMILES | CC(=O)Oc1c(C)cccc1C(=O)O |
| InChI | InChI=1S/C10H10O4/c1-6-4-3-5-8(10(12)13)9(6)14-7(2)11/h3-5H,1-2H3,(H,12,13) |
| InChIKey | XRBMKGUDDJPAMH-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | feces (BTO:0000440) | MetaboLights (MTBLS5335) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| CRESOPYRINE (CHEBI:193212) is a benzoic acids (CHEBI:22723) |
| CRESOPYRINE (CHEBI:193212) is a carboxylic ester (CHEBI:33308) |
| CRESOPYRINE (CHEBI:193212) is a salicylates (CHEBI:26596) |
| IUPAC Name |
|---|
| 2-acetyloxy-3-methylbenzoic acid |