EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H34O3 |
| Net Charge | 0 |
| Average Mass | 334.500 |
| Monoisotopic Mass | 334.25079 |
| SMILES | [H][C@@]12CC[C@]([H])([C@@H](C)O)[C@@]1(C)CC=C1[C@@]2([H])C[C@H](O)[C@@]2([H])C[C@@H](O)CC[C@]12C |
| InChI | InChI=1S/C21H34O3/c1-12(22)15-4-5-16-14-11-19(24)18-10-13(23)6-8-21(18,3)17(14)7-9-20(15,16)2/h7,12-16,18-19,22-24H,4-6,8-11H2,1-3H3/t12-,13+,14+,15-,16+,18-,19+,20-,21-/m1/s1 |
| InChIKey | XCGDFVUIBHDDNK-JMGMBTOPSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | feces (BTO:0000440) | MetaboLights (MTBLS5335) |
| Roles Classification |
|---|
| Biological Role: | androgen A sex hormone that stimulates or controls the development and maintenance of masculine characteristics in vertebrates by binding to androgen receptors. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Asterogenol (CHEBI:193210) has role androgen (CHEBI:50113) |
| Asterogenol (CHEBI:193210) is a 3-hydroxy steroid (CHEBI:36834) |
| IUPAC Name |
|---|
| (3S,5S,6S,8S,10S,13S,14S,17S)-17-[(1R)-1-hydroxyethyl]-10,13-dimethyl-2,3,4,5,6,7,8,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-3,6-diol |
| Manual Xrefs | Databases |
|---|---|
| 2342757 | ChemSpider |
| Registry Numbers | Sources |
|---|---|
| CAS:75921-90-3 | ChemIDplus |