EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H28O8 |
| Net Charge | 0 |
| Average Mass | 456.491 |
| Monoisotopic Mass | 456.17842 |
| SMILES | O=C(CCc1ccccc1)CC(/C=C/c1ccccc1)OC1OC(C(=O)O)C(O)C(O)C1O |
| InChI | InChI=1S/C25H28O8/c26-18(13-11-16-7-3-1-4-8-16)15-19(14-12-17-9-5-2-6-10-17)32-25-22(29)20(27)21(28)23(33-25)24(30)31/h1-10,12,14,19-23,25,27-29H,11,13,15H2,(H,30,31)/b14-12+ |
| InChIKey | PEYXJMQMKHYQIR-WYMLVPIESA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | feces (BTO:0000440) | MetaboLights (MTBLS5335) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3,4,5-trihydroxy-6-{[(1E)-5-oxo-1,7-diphenylhept-1-en-3-yl]oxy}oxane-2-carboxylic acid (CHEBI:193194) is a diarylheptanoid (CHEBI:78802) |
| IUPAC Name |
|---|
| 3,4,5-trihydroxy-6-[(E)-5-oxo-1,7-diphenylhept-1-en-3-yl]oxyoxane-2-carboxylic acid |