EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:193161 - isovanillin
| Formula | C8H8O3 |
| Net Charge | 0 |
| Average Mass | 152.149 |
| Monoisotopic Mass | 152.04734 |
| SMILES | [H]C(=O)c1ccc(OC)c(O)c1 |
| InChI | InChI=1S/C8H8O3/c1-11-8-3-2-6(5-9)4-7(8)10/h2-5,10H,1H3 |
| InChIKey | JVTZFYYHCGSXJV-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mondia whitei (ncbitaxon:244352) | Root (BTO:0001188) | DOI (10.1300/J044v07n03_05) | |
| Pycnocycla spinosa (ncbitaxon:325745) | |||
| - | PubMed (25657776) | ||
| - | PubMed (25657788) | ||
| Arum palaestinum (ncbitaxon:749969) | - | PubMed (26243305) | |
| Apis mellifera (ncbitaxon:7460) | - | PubMed (34227213) | Found in propolis. |
| Lonicera fulvotomentosa (ncbitaxon:643838) | flower bud (BTO:0000470) | PubMed (31835661) | |
| Tachigali paniculata (ncbitaxon:53928) | leaf (BTO:0000713) | PubMed (12444671) | |
| Jatropha curcas (ncbitaxon:180498) | stem (BTO:0001300) | PubMed (23311156) |
| Roles Classification |
|---|
| Biological Roles: | animal metabolite Any eukaryotic metabolite produced during a metabolic reaction in animals that include diverse creatures from sponges, insects to mammals. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. HIV protease inhibitor An inhibitor of HIV protease, an enzyme required for production of proteins needed for viral assembly. EC 1.2.3.1 (aldehyde oxidase) inhibitor An EC 1.2.3.* (oxidoreductase acting on donor aldehyde/oxo group with oxygen as acceptor) inhibitor which interferes with the action of aldehyde oxidase (EC 1.2.3.1). antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. |
| Application: | antidiarrhoeal drug Any drug found useful in the symptomatic treatment of diarrhoea. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| isovanillin (CHEBI:193161) has role animal metabolite (CHEBI:75767) |
| isovanillin (CHEBI:193161) has role antidiarrhoeal drug (CHEBI:55323) |
| isovanillin (CHEBI:193161) has role antifungal agent (CHEBI:35718) |
| isovanillin (CHEBI:193161) has role EC 1.2.3.1 (aldehyde oxidase) inhibitor (CHEBI:62872) |
| isovanillin (CHEBI:193161) has role HIV protease inhibitor (CHEBI:35660) |
| isovanillin (CHEBI:193161) has role plant metabolite (CHEBI:76924) |
| isovanillin (CHEBI:193161) is a benzaldehydes (CHEBI:22698) |
| isovanillin (CHEBI:193161) is a monomethoxybenzene (CHEBI:25235) |
| isovanillin (CHEBI:193161) is a phenols (CHEBI:33853) |
| IUPAC Name |
|---|
| 3-hydroxy-4-methoxybenzaldehyde |
| Synonyms | Source |
|---|---|
| 3-hydroxy-p-anisaldehyde | ChemIDplus |
| 5-formylguaiacol | ChemIDplus |
| isovanilline | ChemIDplus |
| 3-hydroxy-para-anisaldehyde | NIST Chemistry WebBook |
| iso-vanillin | ChEBI |
| 5-formyl-2-methoxyphenol | ChEBI |
| Citations |
|---|