EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:193161 - isovanillin
| Formula | C8H8O3 |
| Net Charge | 0 |
| Average Mass | 152.149 |
| Monoisotopic Mass | 152.04734 |
| SMILES | [H]C(=O)c1ccc(OC)c(O)c1 |
| InChI | InChI=1S/C8H8O3/c1-11-8-3-2-6(5-9)4-7(8)10/h2-5,10H,1H3 |
| InChIKey | JVTZFYYHCGSXJV-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Apis mellifera (ncbitaxon:7460) | - | PubMed (34227213) | Found in propolis. |
| Arum palaestinum (ncbitaxon:749969) | - | PubMed (26243305) | |
| Jatropha curcas (ncbitaxon:180498) | stem (BTO:0001300) | PubMed (23311156) | |
| Lonicera fulvotomentosa (ncbitaxon:643838) | flower bud (BTO:0000470) | PubMed (31835661) | |
| Mondia whitei (ncbitaxon:244352) | Root (BTO:0001188) | DOI (10.1300/J044v07n03_05) | |
| Pycnocycla spinosa (ncbitaxon:325745) | |||
| - | PubMed (25657788) | ||
| - | PubMed (25657776) | ||
| Tachigali paniculata (ncbitaxon:53928) | leaf (BTO:0000713) | PubMed (12444671) |
| Roles Classification |
|---|
| Biological Roles: | antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. EC 1.2.3.1 (aldehyde oxidase) inhibitor An EC 1.2.3.* (oxidoreductase acting on donor aldehyde/oxo group with oxygen as acceptor) inhibitor which interferes with the action of aldehyde oxidase (EC 1.2.3.1). HIV protease inhibitor An inhibitor of HIV protease, an enzyme required for production of proteins needed for viral assembly. animal metabolite Any eukaryotic metabolite produced during a metabolic reaction in animals that include diverse creatures from sponges, insects to mammals. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| Application: | antidiarrhoeal drug Any drug found useful in the symptomatic treatment of diarrhoea. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| isovanillin (CHEBI:193161) has role animal metabolite (CHEBI:75767) |
| isovanillin (CHEBI:193161) has role antidiarrhoeal drug (CHEBI:55323) |
| isovanillin (CHEBI:193161) has role antifungal agent (CHEBI:35718) |
| isovanillin (CHEBI:193161) has role EC 1.2.3.1 (aldehyde oxidase) inhibitor (CHEBI:62872) |
| isovanillin (CHEBI:193161) has role HIV protease inhibitor (CHEBI:35660) |
| isovanillin (CHEBI:193161) has role plant metabolite (CHEBI:76924) |
| isovanillin (CHEBI:193161) is a benzaldehydes (CHEBI:22698) |
| isovanillin (CHEBI:193161) is a monomethoxybenzene (CHEBI:25235) |
| isovanillin (CHEBI:193161) is a phenols (CHEBI:33853) |
| IUPAC Name |
|---|
| 3-hydroxy-4-methoxybenzaldehyde |
| Synonyms | Source |
|---|---|
| 3-hydroxy-para-anisaldehyde | NIST Chemistry WebBook |
| 3-hydroxy-p-anisaldehyde | ChemIDplus |
| 5-formyl-2-methoxyphenol | ChEBI |
| 5-formylguaiacol | ChemIDplus |
| iso-vanillin | ChEBI |
| m-hydroxy-p-methoxybenzaldehyde | ChEBI |
| Citations |
|---|