EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H35NO6 |
| Net Charge | 0 |
| Average Mass | 481.589 |
| Monoisotopic Mass | 481.24644 |
| SMILES | CC1=C\C=C\C=C\C(C)CNC(=O)/C=C(O)/C=C/C(C)=C/C=C/C(O)C(O)C(O)C(=O)/C=C\C=C\1 |
| InChI | InChI=1S/C28H35NO6/c1-20-10-5-4-6-12-22(3)19-29-26(33)18-23(30)17-16-21(2)13-9-15-25(32)28(35)27(34)24(31)14-8-7-11-20/h4-18,22,25,27-28,30,32,34-35H,19H2,1-3H3,(H,29,33)/b5-4+,11-7+,12-6+,14-8-,15-9+,17-16+,20-10+,21-13+,23-18- |
| InChIKey | HRAPIHJIKATMEB-GWVUBWKVSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces sp. (ncbitaxon:1931) | - | PubMed (21247188) | |
| Streptomyces sp. SD85 (ncbitaxon:1849710) | - | PubMed (29371699) |
| Roles Classification |
|---|
| Biological Roles: | bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| sceliphrolactam (CHEBI:193157) has role antifungal agent (CHEBI:35718) |
| sceliphrolactam (CHEBI:193157) has role bacterial metabolite (CHEBI:76969) |
| sceliphrolactam (CHEBI:193157) is a azamacrocycle (CHEBI:52898) |
| sceliphrolactam (CHEBI:193157) is a enamide (CHEBI:51751) |
| sceliphrolactam (CHEBI:193157) is a enol (CHEBI:33823) |
| sceliphrolactam (CHEBI:193157) is a enone (CHEBI:51689) |
| sceliphrolactam (CHEBI:193157) is a lactam (CHEBI:24995) |
| sceliphrolactam (CHEBI:193157) is a polyene antibiotic (CHEBI:26177) |
| sceliphrolactam (CHEBI:193157) is a tetrol (CHEBI:33573) |
| IUPAC Name |
|---|
| (3Z,5E,7E,9E,15Z,17E,19E,21E,23E)-4,11,12,13-tetrahydroxy-7,19,25-trimethylazacyclohexacosa-3,5,7,9,15,17,19,21,23-nonaene-2,14-dione |
| Citations |
|---|