EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H12O6 |
| Net Charge | 0 |
| Average Mass | 276.244 |
| Monoisotopic Mass | 276.06339 |
| SMILES | CC(=O)Oc1ccc2c(C)cc(=O)oc2c1OC(C)=O |
| InChI | InChI=1S/C14H12O6/c1-7-6-12(17)20-13-10(7)4-5-11(18-8(2)15)14(13)19-9(3)16/h4-6H,1-3H3 |
| InChIKey | BENRIKOGQFXSRY-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | radical scavenger A role played by a substance that can react readily with, and thereby eliminate, radicals. |
| Application: | pro-angiogenic agent Any compound that promotes the growth of new blood vessels from pre-existing vessels. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 7,8-diacetoxy-4-methylcoumarin (CHEBI:193139) has functional parent 7,8-dihydroxy-4-methyl-1-benzopyran-2-one (CHEBI:107667) |
| 7,8-diacetoxy-4-methylcoumarin (CHEBI:193139) has role pro-angiogenic agent (CHEBI:72571) |
| 7,8-diacetoxy-4-methylcoumarin (CHEBI:193139) has role radical scavenger (CHEBI:48578) |
| 7,8-diacetoxy-4-methylcoumarin (CHEBI:193139) is a acetate ester (CHEBI:47622) |
| 7,8-diacetoxy-4-methylcoumarin (CHEBI:193139) is a coumarins (CHEBI:23403) |
| 7,8-diacetoxy-4-methylcoumarin (CHEBI:193139) is a diester (CHEBI:51307) |
| IUPAC Name |
|---|
| 4-methyl-2-oxo-2H-chromene-7,8-diyl diacetate |
| Synonyms | Source |
|---|---|
| 4-methyl-2-oxo-2H-1-benzopyran-7,8-diyl diacetate | IUPAC |
| 7,8-dihydroxy-4-methylcoumarin diacetate | ChEBI |
| (8-acetyloxy-4-methyl-2-oxochromen-7-yl) acetate | ChEBI |
| DAMC | SUBMITTER |
| DAMTC | ChEBI |
| Registry Numbers | Sources |
|---|---|
| CAS:68454-15-9 | SUBMITTER |
| Citations |
|---|