EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H18O5 |
| Net Charge | 0 |
| Average Mass | 290.315 |
| Monoisotopic Mass | 290.11542 |
| SMILES | COc1cc(CCc2cc(O)c(O)c(OC)c2)ccc1O |
| InChI | InChI=1S/C16H18O5/c1-20-14-8-10(5-6-12(14)17)3-4-11-7-13(18)16(19)15(9-11)21-2/h5-9,17-19H,3-4H2,1-2H3 |
| InChIKey | DAQVNMKZMKBKOF-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Dendrobium ellipsophyllum (ncbitaxon:179353) | whole plant (BTO:0001461) | PubMed (24692728) | |
| Dendrobium pachyglossum (ncbitaxon:906810) | - | PubMed (33562174) | |
| Dendrobium secundum (ncbitaxon:37622) | aerial part (BTO:0001658) | PubMed (21812336) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| Applications: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. antilipemic drug A substance used to treat hyperlipidemia (an excess of lipids in the blood). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4,5,4'-trihydroxy-3,3'-dimethoxybibenzyl (CHEBI:193138) has parent hydride 1,2-dihydrostilbene (CHEBI:34047) |
| 4,5,4'-trihydroxy-3,3'-dimethoxybibenzyl (CHEBI:193138) has role antilipemic drug (CHEBI:35679) |
| 4,5,4'-trihydroxy-3,3'-dimethoxybibenzyl (CHEBI:193138) has role antineoplastic agent (CHEBI:35610) |
| 4,5,4'-trihydroxy-3,3'-dimethoxybibenzyl (CHEBI:193138) has role plant metabolite (CHEBI:76924) |
| 4,5,4'-trihydroxy-3,3'-dimethoxybibenzyl (CHEBI:193138) is a catechols (CHEBI:33566) |
| 4,5,4'-trihydroxy-3,3'-dimethoxybibenzyl (CHEBI:193138) is a diphenylethane (CHEBI:51571) |
| 4,5,4'-trihydroxy-3,3'-dimethoxybibenzyl (CHEBI:193138) is a methoxybenzenes (CHEBI:51683) |
| IUPAC Name |
|---|
| 5-[2-(4-hydroxy-3-methoxyphenyl)ethyl]-3-methoxybenzene-1,2-diol |
| Synonyms | Source |
|---|---|
| 3',5-dimethoxybibenzyl-3,4,4'-triol | ChEBI |
| 4,5,4'-trihydroxy-3,3'-dimethoxybibenzyl | SUBMITTER |
| TDB | SUBMITTER |
| Citations |
|---|