EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H14NO5 |
| Net Charge | -1 |
| Average Mass | 216.213 |
| Monoisotopic Mass | 216.08775 |
| SMILES | CC(C)(CC[C@H]([NH3+])C(=O)[O-])C(=O)C(=O)[O-] |
| InChI | InChI=1S/C9H15NO5/c1-9(2,6(11)8(14)15)4-3-5(10)7(12)13/h5H,3-4,10H2,1-2H3,(H,12,13)(H,14,15)/p-1/t5-/m0/s1 |
| InChIKey | AEFLBEFDGSFJEE-YFKPBYRVSA-M |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (6S)-6-ammonio-3,3-dimethyl-2-oxoheptanedioate (CHEBI:193109) is a amino acid (CHEBI:33709) |
| (6S)-6-ammonio-3,3-dimethyl-2-oxoheptanedioate (CHEBI:193109) is a dicarboxylic acid dianion (CHEBI:28965) |
| (6S)-6-ammonio-3,3-dimethyl-2-oxoheptanedioate (CHEBI:193109) is a oxo carboxylic acid anion (CHEBI:35903) |
| UniProt Name | Source |
|---|---|
| (6S)-6-amino-3,3-dimethyl-2-oxoheptanedioate | UniProt |
| Citations |
|---|