EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:193093 - sulfoacrylate
| Formula | C3H2O5S |
| Net Charge | -2 |
| Average Mass | 150.111 |
| Monoisotopic Mass | 149.96339 |
| SMILES | O=C([O-])C=CS(=O)(=O)[O-] |
| InChI | InChI=1S/C3H4O5S/c4-3(5)1-2-9(6,7)8/h1-2H,(H,4,5)(H,6,7,8)/p-2 |
| InChIKey | UJTXYFXSCAQCRB-UHFFFAOYSA-L |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| sulfoacrylate (CHEBI:193093) is a acrylic acid (CHEBI:18308) |
| UniProt Name | Source |
|---|---|
| sulfoacrylate | UniProt |
| Citations |
|---|