EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:193058 - fluchloraminopyr-tefuryl
| Formula | C13H15Cl2FN2O4 |
| Net Charge | 0 |
| Average Mass | 353.177 |
| Monoisotopic Mass | 352.03929 |
| SMILES | C[C@@H](Oc1nc(F)c(Cl)c(N)c1Cl)C(=O)OCC1CCCO1 |
| InChI | InChI=1S/C13H15Cl2FN2O4/c1-6(13(19)21-5-7-3-2-4-20-7)22-12-9(15)10(17)8(14)11(16)18-12/h6-7H,2-5H2,1H3,(H2,17,18)/t6-,7?/m1/s1 |
| InChIKey | RTONGXWQCWZDSR-ULUSZKPHSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Application: | proherbicide A compound that, on administration, must undergo chemical conversion by biochemical (enzymatic), chemical (possibly following an enzymatic step), or physical (e.g. photochemical) activation processes before becoming the pharmacologically active herbicide for which it is a proherbicide. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| fluchloraminopyr-tefuryl (CHEBI:193058) has functional parent fluchloraminopyr (CHEBI:193056) |
| fluchloraminopyr-tefuryl (CHEBI:193058) has role proherbicide (CHEBI:136646) |
| fluchloraminopyr-tefuryl (CHEBI:193058) is a tetrahydrofuran-2-ylmethyl 2-[(4-amino-3,5-dichloro-6-fluoropyridin-2-yl)oxy]propanoate (CHEBI:193128) |
| IUPAC Name |
|---|
| tetrahydrofuran-2-ylmethyl (2R)-2-[(4-amino-3,5-dichloro-6-fluoropyridin-2-yl)oxy]propanoate |
| Synonyms | Source |
|---|---|
| [(2Ξ)-oxolan-2-yl]methyl (2R)-2-[(4-amino-3,5-dichloro-6-fluoropyridin-2-yl)oxy]propanoate | Alan Wood's Pesticides |
| (tetrahydro-2-furanyl)methyl (2R)-2-[(4-amino-3,5-dichloro-6-fluoro-2-pyridinyl)oxy]-propanoate | Alan Wood's Pesticides |
| (oxolan-2-yl)methyl (2R)-2-[(4-amino-3,5-dichloro-6-fluoropyridin-2-yl)oxy]propanoate | IUPAC |
| Manual Xrefs | Databases |
|---|---|
| /derivatives/fluchloraminopyr-tefuryl | Alan Wood's Pesticides |
| Registry Numbers | Sources |
|---|---|
| Reaxys:38533821 | Reaxys |
| CAS:2445983-82-2 | Alan Wood's Pesticides |