EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H38O7 |
| Net Charge | 0 |
| Average Mass | 486.605 |
| Monoisotopic Mass | 486.26175 |
| SMILES | [H][C@@]12CC[C@](O)([C@H](C)[C@@]3([H])CC(C)=C(CO)C(=O)O3)[C@@]1(C)CC[C@]1([H])[C@@]3(C)C(=O)C=CC[C@]3(O)[C@H]3O[C@H]3[C@@]21[H] |
| InChI | InChI=1S/C28H38O7/c1-14-12-19(34-24(31)16(14)13-29)15(2)27(32)11-8-17-21-18(7-10-25(17,27)3)26(4)20(30)6-5-9-28(26,33)23-22(21)35-23/h5-6,15,17-19,21-23,29,32-33H,7-13H2,1-4H3/t15-,17+,18+,19-,21+,22+,23+,25+,26+,27+,28+/m1/s1 |
| InChIKey | XOKCBESGXYESDY-LGZUTLPBSA-N |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 27-hydroxywithanone (CHEBI:193033) is a 17α-hydroxy steroid (CHEBI:35342) |
| 27-hydroxywithanone (CHEBI:193033) is a 27-hydroxy steroid (CHEBI:37914) |
| 27-hydroxywithanone (CHEBI:193033) is a 27-hydroxysterols (CHEBI:193031) |
| 27-hydroxywithanone (CHEBI:193033) is a enone (CHEBI:51689) |
| 27-hydroxywithanone (CHEBI:193033) is a epoxy steroid (CHEBI:145217) |
| 27-hydroxywithanone (CHEBI:193033) is a ergostanoid (CHEBI:50403) |
| 27-hydroxywithanone (CHEBI:193033) is a primary alcohol (CHEBI:15734) |
| 27-hydroxywithanone (CHEBI:193033) is a secondary alcohol (CHEBI:35681) |
| 27-hydroxywithanone (CHEBI:193033) is a withanolide (CHEBI:74716) |
| 27-hydroxywithanone (CHEBI:193033) is a δ-lactone (CHEBI:18946) |
| UniProt Name | Source |
|---|---|
| 27-hydroxywithanone | UniProt |
| Manual Xrefs | Databases |
|---|---|
| CPD-24474 | MetaCyc |
| Citations |
|---|