EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C32H36N4O3 |
| Net Charge | 0 |
| Average Mass | 524.665 |
| Monoisotopic Mass | 524.27874 |
| SMILES | [H][C@]12N(C(C)(C)C=C)c3ccccc3[C@@]1(O)C[C@@]1([H])C(=O)N[C@@H](Cc3c(C(C)(C)C=C)nc4ccccc34)C(=O)N21 |
| InChI | InChI=1S/C32H36N4O3/c1-7-30(3,4)26-20(19-13-9-11-15-22(19)33-26)17-23-28(38)35-25(27(37)34-23)18-32(39)21-14-10-12-16-24(21)36(29(32)35)31(5,6)8-2/h7-16,23,25,29,33,39H,1-2,17-18H2,3-6H3,(H,34,37)/t23-,25-,29-,32-/m0/s1 |
| InChIKey | YWLAQSLUIQTZON-FQPFCCRUSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Penicillium simplicissimum (ncbitaxon:69488) | - | DOI (10.1080/00021369.1991.10857916) | Strain: AHU 8402 |
| Roles Classification |
|---|
| Biological Roles: | Penicillium metabolite Any fungal metabolite produced during a metabolic reaction in Penicillium. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | insecticide Strictly, a substance intended to kill members of the class Insecta. In common usage, any substance used for preventing, destroying, repelling or controlling insects. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| okaramine C (CHEBI:193028) has role Penicillium metabolite (CHEBI:76964) |
| okaramine C (CHEBI:193028) has role insecticide (CHEBI:24852) |
| okaramine C (CHEBI:193028) is a indole alkaloid (CHEBI:38958) |
| okaramine C (CHEBI:193028) is a olefinic compound (CHEBI:78840) |
| okaramine C (CHEBI:193028) is a organic heterotetracyclic compound (CHEBI:38163) |
| okaramine C (CHEBI:193028) is a tertiary alcohol (CHEBI:26878) |
| IUPAC Name |
|---|
| (3S,5aR,10bS,11aS)-10b-hydroxy-6-(2-methylbut-3-en-2-yl)-3-{[2-(2-methylbut-3-en-2-yl)-1H-indol-3-yl]methyl}-6,10b,11,11a-tetrahydro-2H-pyrazino[1',2':1,5]pyrrolo[2,3-b]indole-1,4(3H,5aH)-dione |
| Synonym | Source |
|---|---|
| (+)-okaramine C | ChEBI |
| UniProt Name | Source |
|---|---|
| okaramine C | UniProt |
| Manual Xrefs | Databases |
|---|---|
| C00026640 | KNApSAcK |
| Registry Numbers | Sources |
|---|---|
| CAS:142677-16-5 | ChemIDplus |
| Citations |
|---|