EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H26N3O2 |
| Net Charge | -1 |
| Average Mass | 388.491 |
| Monoisotopic Mass | 388.20305 |
| SMILES | C=CC(C)(C)c1nc2ccc(CC=C(C)C)cc2c1/C=c1/[n-]c(=O)c(=C)nc1=O |
| InChI | InChI=1S/C24H27N3O2/c1-7-24(5,6)21-18(13-20-23(29)25-15(4)22(28)27-20)17-12-16(9-8-14(2)3)10-11-19(17)26-21/h7-8,10-13H,1,4,9H2,2-3,5-6H3,(H3,25,26,27,28,29)/p-1 |
| InChIKey | GTMHFJGKEYNNHJ-UHFFFAOYSA-M |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| isoechinulin B anion (CHEBI:193026) is a 2,5-diketopiperazines (CHEBI:65061) |
| isoechinulin B anion (CHEBI:193026) is conjugate base of isoechinulin B (CHEBI:193012) |
| Incoming Relation(s) |
| isoechinulin B (CHEBI:193012) is conjugate acid of isoechinulin B anion (CHEBI:193026) |
| UniProt Name | Source |
|---|---|
| isoechinulin B | UniProt |
| Citations |
|---|