EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H28O4 |
| Net Charge | 0 |
| Average Mass | 332.440 |
| Monoisotopic Mass | 332.19876 |
| SMILES | [H][C@@]12[C@@H](O)[C@H](O)C(C)(C)[C@]13O[C@@](C)(O[C@@H]3Cc1cccc(C)c1)[C@@H]2C |
| InChI | InChI=1S/C20H28O4/c1-11-7-6-8-13(9-11)10-14-20-15(12(2)19(5,23-14)24-20)16(21)17(22)18(20,3)4/h6-9,12,14-17,21-22H,10H2,1-5H3/t12-,14-,15-,16-,17+,19-,20-/m1/s1 |
| InChIKey | NDPVYKDORPXALK-BJKYDIMVSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Rhododendron molle (ncbitaxon:49168) | leaf (BTO:0000713) | PubMed (29533072) |
| Roles Classification |
|---|
| Biological Roles: | EC 3.1.3.48 (protein-tyrosine-phosphatase) inhibitor An EC 3.1.3.* (phosphoric monoester hydrolase) inhibitor which interferes with the activity of the enzyme protein tyrosine phosphatases (PTPs), EC 3.1.3.48, involved in the removal of phosphate groups from phosphorylated tyrosine residues on proteins. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| mollebenzylanol B (CHEBI:193001) has role EC 3.1.3.48 (protein-tyrosine-phosphatase) inhibitor (CHEBI:35608) |
| mollebenzylanol B (CHEBI:193001) has role plant metabolite (CHEBI:76924) |
| mollebenzylanol B (CHEBI:193001) is a cyclic ether (CHEBI:37407) |
| mollebenzylanol B (CHEBI:193001) is a diol (CHEBI:23824) |
| mollebenzylanol B (CHEBI:193001) is a toluenes (CHEBI:27024) |
| mollebenzylanol B (CHEBI:193001) is a tricyclic diterpenoid (CHEBI:79084) |
| IUPAC Name |
|---|
| (1R,3R,4R,4aR,5R,6R,7aR)-3,4,7,7-tetramethyl-1-(3-methylbenzyl)hexahydro-3,7a-epoxycyclopenta[c]pyran-5,6(1H)-diol |
| Citations |
|---|